Bài giảng Chương 3: Liên kết hoá học (tiếp)

Dựa vào độ âm điện, hãy nêu bản chất liên kết trong các phân tử và ion: HClO, KHS, HCO3-.

 (Cho: nguyên tố: K H C S Cl O

 Độ âm điện: 0,8 2,1 2,5 2,5 3, 3,5).

 

doc10 trang | Chia sẻ: maika100 | Lượt xem: 1811 | Lượt tải: 0download
Bạn đang xem nội dung tài liệu Bài giảng Chương 3: Liên kết hoá học (tiếp), để tải tài liệu về máy bạn click vào nút DOWNLOAD ở trên
a natri trong NaCl là
A : +1	B : 1+	C : 1 D. 1-
8.	Số oxi hóa của nguyên tử C trong CO2, H2CO3, HCOOH, CH4 lần lượt là
A. -4; + 4; +3; +4	B. +4; +4; +2; +4
C. +4; +4; +2; -4	D. +4; -4; +3; +4
9.	Các liên kết trong phân tử nitơ gồm
A. 3 liên kết p.	B. 1 liên kết p, 2 liên kết s.
C. 1 liên kết s, 2 liên kết p.	D. 3 liên kết s.
10.	Cộng hóa trị của nitơ trong hợp chất nào sau đây là lớn nhất ?
A. N2	B. NH3	C. NO 	D. HNO3	
11. 	 Liên kết hoá học trong phân tử HCl là :
A. liên kết ion.
B. liên kết cộng hoá trị phân cực
C. liên kết cho - nhận.
D. liên kết cộng hoá trị không phân cực.
12.	Công thức electron của Cl2 là :
A. 	B. 	C. 	D. 
13.	Mạng tinh thể kim cương thuộc loại
A. mạng tinh thể kim loại.	B. mạng tinh thể nguyên tử.
C. mạng tinh thể ion.	D. mạng tinh thể phân tử.
14.	Cho biết độ âm điện của O là 3,44 và của Si là 1,90. Liên kết trong phân tử SiO2 là liên kết
A. ion.	B. cộng hoá trị phân cực.
C. cộng hoá trị không phân cực.	D. phối trí.
15.	Số oxi hoá của Mn trong K2MnO4 là :
A. +7	B.+6	C. -6	D. +5
16.	Cộng hoá trị của cacbon và oxi trong phân tử CO2 là :
A. 4 và 2	B. 4 và -2	C. +4 và -2	D. 3 và 2
III. Hướng dẫn giải – Đáp án
1. Trong HClO: H-O-Cl có liên kết H-O là cộng hoá trị phân cực (Dc = 1,4) 
	liên kết O-Cl là cộng hoá trị phân cực yếu (Dc = 0,5)
	Trong KHS: K-S-H có liên kết K-S là liên kết ion (Dc = 1,7)
	liên kết S-H là cộng hoá trị phân cực yếu (Dc = 0,4)
2. Thứ tự tăng dần độ phân cực của liên kết:
N2,
CH4,
BCl3,
AlN,
AlCl3 ,
NaBr,
MgO,
CaO
Dc =
0,0
0,4
1,0
1,5
1,5
1,9
2,3
2,5
	- Phân tử chất có liên kết ion: NaBr, MgO, CaO
	- Phân tử chất có liên kết cộng hoá trị có cực: CH4, BCl3, AlN, AlCl3
	- Phân tử chất có liên kết cộng hoá trị không cực: N2,
3. (SGK hoá học 10). 
4. Ở điều kiện thường, phân tử N2 có liên kết ba bền vững (NºN) hơn so với phân tử Cl2 chỉ có liên kết đơn (Cl-Cl) Þ phân tử kém bền hơn sẽ có tính oxi hoá mạnh hơn
5. a) (SGK hoá học 10)
	b) Phân tử naptalen và iot có cấu trúc bền vững bởi các liên kết cộng hoá trị kém phân cực, đồng thời liên kết liên phân tử cũng kém bền vững (không ở dạng mạng tinh thể) nên khi đun nóng dễ dàng tách ra khỏi nhau nhanh đến làm tăng nhanh khoảng cách giữa các phân tử (thăng hoa). Ngược lại, phân tử NaCl có cấu trúc bền vững theo kiểu mạng tinh thể tạo bởi các liên kết ion (khó thăng hoa), khi nóng chảy có thể phân li thành các ion dương và ion âm Þ dẫn điện. 
6. Khi hình thành liên kết H + H → H2 hệ toả ra năng lượng và ngược lại khi phá vỡ liên kết H2 → H + H thì thu thêm năng lượng ?
Xét về mặt năng lượng thì phân tử H2 có năng lượng lớn hơn hệ hai nguyên tử H riêng rẽ ? Trong hai hệ đó thì hệ H2 bền hơn hệ 2H?
7. 	a) Na → Na+ + e và Cl + e → Cl- Þ 2Na + Cl2 → 2Na+ + 2Cl- → 2NaCl
	b) Ca → Ca2+ + 2e và F + e → F- Þ Ca + F2 → Ca2+ + 2F- → CaF2
	b) Mg → Mg2+ + 2e và O + 2e → O2- Þ 2Mg + O2 → 2Mg2+ + 2O2- → 2MgO
	b) Al → Al3+ + 3e và O + 2e → O2- Þ 4Al + 3O2 → 4Al3+ + 6O2- → 2Al2O3
8. Viết công thức cấu tạo và cho biết cộng hoá trị của các nguyên tố trong các chất sau:
 	N2, NH3, N2O, NO2, N2O5, HNO3
9. a) Viết công thức cấu tạo của các ion sau: CO32-, NO3-, SO42-, NH4+.
b) Xác định tổng số electron trong mỗi ion trên.
10. a)
11. Dự đoán dạng hình học của các phân tử sau (không cần giải thích):
- Dạng đường thẳng: BeH2, CO2, HCN, C2H2
- Dạng chữ V (tam giác phẳng): SO2, H2O, SCl2, OF2,
- Dạng tứ diện: CH4, NH3
12. Trạng thái lai hoá của các nguyên tử C trong phân tử ghi lần lượt từ trái qua phải:
	CH3-CH=CH-CH(CH3)-CH=C(CH3)-CºCH
	 sp3 - sp2 - sp2 - sp3 - sp2 - sp2 - sp - sp
Đáp án câu hỏi, bài tập trắc nghiệm khách quan 
Câu
1
2
3
4
5
6
7
8
9
10
11
12
13
14
15
16
ĐA
C
C
D
C
B
D
B
C
C
D
B
A
B
B
B
A
IV. Đề kiểm tra
Đề kiểm tra 15 phút số 1 (mỗi câu 1,0 điểm)
1. Tính chất nào dưới đây là tính chất của hợp chất ion?
A. Hợp chất ion có nhiệt độ nóng chảy thấp.	 	
B. Hợp chất ion có nhiệt độ nóng chảy cao.	
C. Hợp chất ion có dễ hoá lỏng.	
D. Hợp chất ion có có nhiệt độ sôi không xác định.
2. Nguyên tố nào dưới đây có độ âm điện lớn nhất trong bảng tuần hoàn?
A. Oxi	B. Clo	C. Brom	D. Flo
3. Cặp nguyên tử nào dưới đây tạo hợp chất cộng hoá trị?
A. H và He.	 B. Na và F. 	C. H và Cl.	 D. Li và F.
4. Liên kết trong phân tử nào được hình thành nhờ sự xen phủ p – p?
A. H2	 B. Cl2	C. NH3	 D. HCl
5. Cho 2 nguyên tố: X (Z = 20), Y (Z = 17). Công thức hợp chất tạo thành từ X, Y và liên kết trong phân tử lần lượt là
A. XY: liên kết cộng hoá trị.	B. X2Y3: liên kết cộng hoá trị.
C. X2Y: liên kết ion.	D. XY2: liên kết ion.
6. Công thức cấu tạo của phân tử HCl là
A. H − Cl 	B. H→Cl	C. H = Cl	D. Cl→H
7. Điện hoá trị của các nguyên tố O, S trong các hợp chất với các nguyên tố nhóm IA đều là
A. 2−	 B. 2+	C.6−	 D. 6+
8. Số oxi hóa của nitơ trong , HNO3 , NH3 lần lượt là
A. 3 ; +5 ; −3.	B. −3 ; + 4 ; +5.	C. −3 ; +5 ; −3.	D. +3 ; +5 ; +3.
9. Theo quy tắc bát tử, nguyên tử S trong phân tử SO3 có cộng hóa trị là
A. 6.	B. 4.	C. 2.	D. 3.
10. Mạng tinh thể ion có đặc tính nào dưới đây?
A. Bền vững, nhiệt độ nóng chảy và nhiệt độ sôi thấp.
B. Dễ bay hơi.
C. Bền vững, nhiệt độ nóng chảy và nhiệt độ sôi khá cao.
D. Bền vững, nhiệt độ nóng chảy cao và nhiệt độ sôi thấp.
Đề kiểm tra 15 phút số 2 (mỗi câu 1,0 điểm)
1. Liên kết hoá học trong phân tử Cl2 là
A. liên kết ion.	B. liên kết cộng hoá trị không phân cực.
C. liên kết cộng hóa trị phân cực.	D. liên kết cho − nhận (phối trí).
2. Trong ion có các loại liên kết nào dưới đây?
A. Liên kết kim loại.	B. Liên kết ion.
C. Liên kết cộng hóa trị có cực. 	D. Liên kết cộng hoá trị không cực.
3. Dãy chỉ chứa các hợp chất có liên kết cộng hoá trị là
A. BaCl2, NaCl, NO2.	B. SO2, CO2, Na2O2.
C. SO3, H2S, H2O.	D. CaCl2, F2O, HCl.
4. Liên kết trong phân tử N2 gồm
A. một liên kết đôi.	B. hai liên kết đơn.
C. một liên kết ba.	D. một liên kết đơn, một liên kết ba.
5. Các nguyên tố X (Z = 8), Y (Z = 16), T (Z = 19), G (Z = 20) có thể tạo được tối đa bao nhiêu hợp chất ion và hợp chất cộng hóa trị chỉ gồm 2 nguyên tố? (chỉ xét các hợp chất đã học trong chương trình phổ thông)
A. Ba hợp chất ion và ba hợp chất cộng hóa trị.	
B. Hai hợp chất ion và bốn hợp chất cộng hoá trị.	 
C. Năm hợp chất ion và một hợp chất cộng hóa trị	 
D. Bốn hợp chất ion và hai hợp chất cộng hóa trị.	
6. Công thức cấu tạo đúng của CO2 là
A. O = O - C	B. O - C = O	C. O = C = O	D. O ← C = O
7. Nguyên tử nguyên tố X (Z = 12) có điện hoá trị trong hợp chất với nguyên tử các nguyên tố nhóm VIIA là
A. 2+.	B. 2−.	C. 7+.	D. 7−.
8. Số oxi hóa của lưu huỳnh trong các phân tử H2SO3, S8, SO3, H2S lần lượt là
A. +6 ; + 8 ; +6 ; −2.	B. +4 ; 0 ; +6 ; −2.
C. +4 ; −8 ; +6 ; −2.	D. +4 ; 0 ; +4 ; −2.
9. Trong các phân tử N2, NaCl, HNO3, H2O2, phân tử có liên kết cho − nhận là
A. H2O2. B. NaCl.	 	C. HNO3.	 D. N2 và H2O2.	
10. Chọn câu đúng khi nói về mạng tinh thể nguyên tử.
A. Liên kết trong mạng là liên kết Van đec van.
B. Chất có cấu tạo mạng tinh thể nguyên tử có nhiệt độ nóng chảy thấp.
C. Chất có cấu tạo mạng tinh thể nguyên tử có độ cứng nhỏ.
D. Chất có cấu tạo mạng tinh thể nguyên tử có nhiệt độ nóng chảy cao.
Đề kiểm tra 45 phút số 1
A. Trắc nghiệm khách quan (3,0 điểm, mỗi câu 0,5 điểm)
1. Cho các phân tử sau : HCl, NaCl, CaCl2, AlCl3, CCl4. Phân tử có liên kết mang nhiều tính chất ion nhất là
A. HCl.	 	 B. NaCl.	C. CaCl2.	D. AlCl3.	
2. Phân tử nào dưới đây có liên kết cộng hoá trị phân cực?
A. HCl	 B. Cl2	C. KCl	 D. H2
3. Trong công thức CS2, tổng số đôi electron lớp ngoài cùng của C và S chưa tham gia liên kết là
A. 2	 B. 3	C. 4	 D. 5	
4. Theo quy tắc bát tử thì công thức cấu tạo của phân tử SO2 là 
A. O = S ® O	B. O = S = O	C. O − S − O	D. O® S ®O
5. Chọn sơ đồ nửa phản ứng đúng trong các sơ đồ dưới đây: 
A. Na + 1e	® Na+	B. Cl2	− 2e	® 2Cl−
C. O2	+ 2e	® 2O2−	D. Al ® Al3+ + 3e
6. Số oxi hoá của lưu huỳnh trong ion là
A. +8	B. −6	C. +6	D. +4
B. Trắc nghiệm tự luận (7,0 điểm)
7. (1,5 điểm) Viết công thức cấu tạo và cho biết cộng hoá trị của các nguyên tố trong các chất sau: SO2, SO3, H2S, H2SO4
8. (1,5 điểm) So sánh độ phân cực của liên kết trong phân tử các chất sau:
 	NH3, H2S, H2O, CaS, BaF2.
	(Cho độ âm điện: Ba = 0,9; Ca = 1; H = 2,1; S = 2,5; N = 3; O = 3,5; F = 4).
9. (4,0 điểm) Hợp chất X tạo bởi 2 nguyên tố A, B có khối lượng phân tử là 76. A và B có số oxi hoá dương cao nhất trong các oxit là + a và + b và có số oxi hoá âm trong các hợp chất với hiđro là – a’ và – b’ thoả mãn các điều kiện: a = a’ và b = 3b’
 	a) Hãy thiết lập công thức phân tử của X. Biết rằng A có số oxi hoá cao nhất trong X.
	b) Viết công thức cấu tạo của X, cho biết hình dạng phân tử, trạng thái lai hoá và loại liên kết có trong X
Đề kiểm tra 45 phút số 2
A. Trắc nghiệm khách quan (3,0 điểm, mỗi câu 0,5 điểm)
1. Phân tử nào dưới đây có liên kết cộng hoá trị không phân cực?
A. K2O	 B. NaF	C. HF	 D. N2	
2. Hợp chất nào dưới đây có cả liên kết cộng hoá trị và liên kết ion trong phân tử?
A. H2S	B. Al2O3	C. H2O	D. Mg(OH)2
3. Liên kết hoá học trong phân tử HCl được hình thành do
A. lực hút tĩnh điện giữa ion H+ và ion Cl−.
B. sự xen phủ giữa obitan 1s của nguyên tử H và các obitan 3p của nguyên tử Cl.
C. sự xen phủ giữa obitan 1s của nguyên tử H với obitan 3s của nguyên tử Cl.
D. sự xen phủ giữa obitan 1s của nguyên tử H với obitan 3p có electron độc thân của nguyên tử Cl.
4. Công thức electron của HCl là
A. 	B. 	C. D. 
5. Quy tắc bát tử không đúng với trường hợp phân tử chất nào dưới đây?
A. H2O	B. NO2	 	C. CO2 	 	D. Cl2
6. Hoá trị của lưu huỳnh trong CS2 là
A. −2. B. 2. 	C. 1. D. −1.
B. Trắc nghiệm tự luận (7,0 điểm)
7. (1,5 điểm)
a) Hãy viết công thức cấu tạo của các phân tử : 
	b) Dựa vào quy tắc biến thiên độ âm điện của các nguyên tố trong một chu kì, hãy cho biết trong các phân tử nói trên, phân tử nào có liên kết không phân cực, phân tử nào có liên kết phân cực mạnh nhất. 
8. (1,5 điểm)
a) Hãy cho biết, hoá trị của một nguyên tố trong các hợp chất ion được gọi là gì ? Hãy so sánh hoá tr

File đính kèm:

  • docchuong 3.doc
Giáo án liên quan