Đề 10 thi thử tuyển sinh đại học, cao đẳng năm 2009 môn thi : hoá

Cho biết khối lượng nguyên tử (theo đvC) của các nguyên tố :

H = 1; Li = 7; C = 12; N = 14; O = 16; Na = 23; Mg = 24; Al = 27; P = 31; S = 32; Cl = 35,5;

K = 39; Ca = 40; Fe = 56; Cu = 64; Zn = 65; As = 75 ; Br = 80; Rb = 85,5; Ag = 108; Ba = 137.

ĐỀ SỐ 10

1. Trong cùng một lớp, electron thuộc phân lớp nào có mức năng lượng thấp nhất?

 A. phân lớp s. B. phân lớp p. C. phân lớp d. D. phân lớp f.

2. Nguyên tử Ag có 2 đồng vị 109Ag, 107Ag. Biết 109Ag chiếm 44%. Vậy khối lượng nguyên tử trung bình của Ag là

 A. 106,8. B. 107,88. C. 108. D. 109,5.

 

doc5 trang | Chia sẻ: maika100 | Ngày: 18/01/2016 | Lượt xem: 139 | Lượt tải: 0download
Bạn đang xem nội dung tài liệu Đề 10 thi thử tuyển sinh đại học, cao đẳng năm 2009 môn thi : hoá, để tải tài liệu về máy bạn click vào nút DOWNLOAD ở trên
ĐỀ THI THỬ TUYỂN SINH ĐẠI HỌC, CAO ĐẲNG NĂM 2009
Môn thi : HOÁ
Cho biết khối lượng nguyên tử (theo đvC) của các nguyên tố :
H = 1; Li = 7; C = 12; N = 14; O = 16; Na = 23; Mg = 24; Al = 27; P = 31; S = 32; Cl = 35,5; 
K = 39; Ca = 40; Fe = 56; Cu = 64; Zn = 65; As = 75 ; Br = 80; Rb = 85,5; Ag = 108; Ba = 137.
ĐỀ SỐ 10
Trong cùng một lớp, electron thuộc phân lớp nào có mức năng lượng thấp nhất?
	A. phân lớp s.	B. phân lớp p.	C. phân lớp d.	D. phân lớp f.
Nguyên tử Ag có 2 đồng vị 109Ag, 107Ag. Biết 109Ag chiếm 44%. Vậy khối lượng nguyên tử trung bình của Ag là
	A. 106,8.	B. 107,88.	C. 108.	D. 109,5.
Cation nào sau đây có bán kính nhỏ nhất?
	A. Na+.	B. K+.	C. Mg2+.	D. Ca2+.
Tính nồng độ ion nitrat có trong 200ml dung dịch chứa HNO3 0,02M và NaNO3 0,03M.
	A. 0,05M.	B. 0,003M.	C. 0,002M.	D. 0,5M.
X là một a-aminoaxit no, mạch nhánh chỉ chứa một nhóm -NH2 và một nhóm -COOH. Cho 23,4 gam X tác dụng với dung dịch HCl dư thu được 30,7 gam muối. Công thức cấu tạo thu gọn của X là
	A. CH3-CH2-CH2-CH(NH2)-COOH.
	B. H2N-CH2-COOH.
	C. H2N-CH(CH3)-CH2-COOH.
	D. CH3-CH(CH3)-CH(NH2)-COOH.
Cho biết ion nào trong số các ion sau là chất lưỡng tính?
HCO3-, H2O, HSO4-, HS-, NH4+
	A. HCO3-, HSO4-, HS-.	B. HCO3-, NH4+, H2O.
	C. H2O, HSO4-, NH4+.	D. HCO3-, H2O, HS-.
Cần bao nhiêu lít HCl (0oC, 2 atm) để pha chế được 1 lít dung dịch có pH = 2?
	A. 0,224 lít.	B. 1,12 lít.	C. 4,48 lít.	D. 0,112 lít.
Đi từ nitơ đến bitmut
	A. khả năng oxi hoá giảm dần.	B. độ âm điện tăng dần.
	C. bán kính nguyên tử tăng dần.	D. khối lượng nguyên tử tăng dần.
Chọn phát biểu sai.
Dung dịch amoniac có môi trường bazơ yếu nên
	A. làm đổi màu quỳ tím thành xanh.
	B. hoà tan hiđroxit lưỡng tính Al(OH)3.
	C. tác dụng với các chất Cu(OH)2, Zn(OH)2, AgOH tạo thành phức chất.
	D. có thể phản ứng với các muối mà kim loại có hiđroxit không tan.
Chọn câu sai.
Cho phản ứng hoá học sau:
N2 + 3H2 2NH3 ; DH < 0
Cân bằng trên sẽ chuyển dịch theo chiều thuận khi nào?
	A. Tăng nhiệt độ.	
	B. Giảm áp suất của hệ.
	C. Thêm chất xúc tác.
	D. Hoá lỏng amoniac để tách ra khỏi hỗn hợp phản ứng.
HNO3 được diều chế theo sơ đồ sau:
NH3 ¾® NO ¾® NO2 ¾® HNO3
Từ 6,72 lít NH3 (đktc) thì thu được bao nhiêu lít dung dịch HNO3 3M. Biết hiệu suất của cả quá trình là 80%?
	A. 0,3 lít.	B. 0,33 lít.	C. 0,08 lít.	D. 3,3 lít.	
Supephotphat kép có công thức là
	A. Ca(H2PO4)2.	B. CaHPO4.
	C. Ca3 (PO4)2.	D. Ca(H2PO4)2 + 2CaSO4.
Than cháy trong oxi tinh khiết và trong không khí có giống nhau không? 
	A. than cháy trong oxi tinh khiết và trong không khí như nhau.
	B. than cháy trong oxi tinh khiết mạnh hơn.
	C. than cháy trong không khí mạnh hơn.
	D. không xác định được.
Ozon có rất nhiều ứng dụng trong thực tiễn như: Tẩy trắng thực phẩm,khử trùng nước ăn, khử mùi, chữa sâu răng .v.v... Nguyên nhân dẫn đến ozon có những ứng dụng đó là vì
	A. ozon kém bền.	B. ozon có tính khử mạnh.
	C. ozon có tính oxi hóa mạnh.	D. một nguyên nhân khác.
Dung dịch H2S trong nước khi để lâu ngày trở nên đục. Hiện tượng này được giải thích như sau
	A. H2S bị phân hủy thành H2 và S.
	B. H2S bị oxi hóa không hoàn toàn thành H2O và S.
	C. H2S bị oxi hóa hoàn toàn thành H2O và SO2.
	D. H2S phản ứng với SO2 trong không khí tạo thành H2O và S.
Phản ứng nào sau đây được dùng để điều chế khí CO trong công nghiệp?
	A. 2C + O2 ¾® 2CO	B. HCOOH CO + H2O
	C. C + H2O CO + H2	D. 3C + Fe2O3 ¾® 3CO + 2Fe
Chất nào sau đây được dùng làm thuốc chữa bệnh đau dạ dày?
	A. natricacbonat.	B. natrihiđrocacbonat.
	C. canxicacbonat.	D. magiecacbonat.
Điện phân dung dịch NaCl loãng không có màng ngăn, dung dịch thu được có tên là
	A. nước Javen.	B. nước tẩy màu.
	C. nước cường thuỷ.	D. nước clo.
Dung dịch NaHCO3 có pH
	A. 7.	D. không xác định. 
Cho sắt phản ứng với HNO3 rất loãng thu được NH4NO3, có phương trình ion thu gọn là
	A. 8Fe + 30H+ + 6NO3- ¾® 8Fe3+ + 3NH4NO3 + 9H2O
	B. 8Fe + 30HNO3 ¾® 8Fe3+ + 3NH4NO3 + 9H2O
	C. 3Fe + 48H+ + 8NO3- ¾® 3Fe2+ + 8NH4+ + 24H2O
	D. 8Fe + 30H+ + 3NO3- ¾® 8Fe3+ + 3NH4+ + 9H2O
Muối FeCl2 thể hiện tính oxi hóa khi phản ứng với chất nào sau đây?
	A. Cl2.	B. AgNO3.	C. Zn.	D. dd HNO3.
Nhỏ từ từ dung dịch H3PO4 vào dung dịch Ba(OH)2 cho đến dư thấy
	A. không có hiện tượng gì.
	B. xuất hiện kết tủa trắng không tan.
	C. xuất hiện kết tủa trắng và tan ngay.
	D. xuất hiện kết tủa trắng sau đó kết tủa tan dần tạo dung dịch trong suốt.
Hoà tan hết 9,2 gam một kim loại kiềm Y vào 100 gam nước. Sau khi phản ứng xong dung dịch còn lại 108,8 gam. Thể tích dung dịch HCl 0,5 M cần để trung hoà hết dung dịch trên là
	A. 400 ml.	B. 1600 ml.	C. 600ml.	D. 800 ml.
Điện phân dung dịch chứa các muối: AgNO3, Ni(NO3)2, Cu(NO3)2. Thứ tự khử các cation kim loại trên catot là
	A. Ag+ > Ni2+ > Cu2+.	B. Ag+ > Cu2+ > Ni2+.
 C. Ni2+ > Cu2+ > Ag+.	D. Cu2+ > Ni2+ > Ag+.
Trong tự nhiên clo không tồn tại ở dạng đơn chất mà luôn tồn tại ở dạng hợp chất vì
	A. clo có tính oxi hóa mạnh.	B. clo có tính khử hóa mạnh. 
	C. clo luôn phản ứng với nước.	D. cả A, B, C đều đúng.
Cho Na vào dung dịch CuSO4 thấy
	A. Na tan và xuất hiện chất rắn màu đỏ.
	B. Na tan và có khí không màu thoát ra.
	C. Na tan và có khí không màu thoát ra đồng thời xuất hiện kết tủa xanh nhạt.
	D. Có kết tủa xanh nhạt.
Tại sao khi hòa tan Zn bằng dung dịch HCl, nếu thêm vài giọt muối Cu2+ thì quá trình hòa tan xảy ra nhanh hơn (khí thoát ra mạnh hơn)?
	A. Muối Cu2+ có tác dụng xúc tác cho phản ứng.
	B. Xảy ra sự ăn mòn hóa học.
	C. Tạo ra dạng hỗn hống.
	D. Xảy ra sự ăn mòn điện hóa.
Axit nào sau đây mạnh nhất?
	A. H2SiO3.	B. H3PO4.	C. H2SO4.	D. HClO4.
Để nhận ra Na2CO3, MgCl2, AlCl3, cần dùng
	A. dd Ba(OH)2.	B. Ca(OH)2.	C. NaOH.	D. BaCl2.
Trong phản ứng nào sau đây FeO đóng vai trò là oxit bazơ?
	A. FeO + Al.	B. FeO + O2.	C. FeO + H2.	D. FeO + HCl.
Cho 6,6 gam hỗn hợp axit axetic và một axit hữu cơ đơn chức B tác dụng hết với dung dịch KOH thu được 10,4 gam hai muối khan. Tổng số mol hai axit đã dùng là
	A. 0,15.	B. 0,2.	C. 0,05.	D. 0,1.
Hòa tan hết 5,6 gam Fe bằng một lượng vừa đủ dung dịch HNO3 đặc nóng thu được V lít NO2 là sản phẩm khử duy nhất (đktc). V nhận giá trị nhỏ nhất là
	A. 1,12 lít.	B. 2,24 lít.	C. 4,48 lít.	D. 6,72 lít.
Dung dịch A chứa 0,01 mol Fe(NO3)3 và 0,15 mol HCl có khả năng hòa tan tối đa bao nhiêu gam Cu kim loại? (Biết NO là sản phẩm khử duy nhất)
	A. 2,88 gam.	B. 3,92 gam.	C. 3,2 gam.	D. 5,12 gam.
Cho hiđrocacbon X có công thức phân tử là C7H8. Cho 4,6 gam X tác dụng với lượng dư AgNO3/NH3 thu được 15,3 gam kết tủa. X có tối đa bao nhiêu công thức cấu tạo?
	A. 3.	B. 4.	C. 5.	D. 6.
C4H8 có bao nhiêu đồng phân mạch hở
	A. 2.	B. 3.	C. 4.	D. 5.
Dùng những hoá chất nào sau đây có thể nhận biết được 4 chất lỏng không màu là etylen glicol, rượu etylic, glucozơ, phenol?
	A. dung dịch Br2 và Cu(OH)2.	B. AgNO3/NH3 và Cu(OH)2.
	C. Na và dung dịch Br2.	D. Na và AgNO3/NH3.
Đốt cháy hoàn toàn 0,9 gam một hợp chất hữu cơ A thu được 1,32 gam CO2 và 0,54 gam H2O. A có KLPT là 180. Công thức phân tử của A là
	A. C5H10O5.	B. C2H4O2.	C. C6H12O6.	D. C5H8O7.
Cho 2,5 kg glucozơ chứa 20% tạp chất lên men thành rượu etylic. Trong quá trình chế biến rượu bị hao hụt 10%. Tính khối lượng rượu thu được?
	A. 0,92 kg.	B. 0,575 kg.	C. 0,51 kg.	D. 5,15 kg.
Cho vài giọt anilin vào nước, quan sát hiện tượng; thêm HCl vào dung dịch, quan sát hiện tượng rồi cho tiếp vài giọt NaOH, quan sát hiện tượng. Các hiện tượng xảy ra lần lượt là
	A. anilin tan, xuất hiện kết tủa, kết tủa tan.
	B. thấy vẩn đục, vẩn đục tan, thấy vẩn đục.
	C. thấy vẩn đục, vẩn đục không thay đổi, vẩn đục tan.
	D. thấy vẩn đục, vẩn đục tan, không hiện tượng gì.
Ghép tên ở cột 1 và CTCT ở cột 2 cho phù hợp:
Cột 1
Cột 2
1. isopropyl axetat
2. allylacrylat 
3. phenyl axetat
4. sec-butyl fomiat
a. C6H5OOC-CH3
b. CH3COOCH(CH3)2
c. CH2=CHCOOCH=CH2
d. CH2=CHCOOCH-CH=CH2
e. HCOOCH(CH3)CH2CH3
	A. 1-b, 2-d, 3-a, 4-e.	B. 1-b, 2-c, 3-a, 4-e.
	C. 1-d, 2-d, 3-a, 4-e.	D. 1-b, 2-d, 3-a, 4-c.
Thủy phân 1 mol este cho 2 muối và nước. CTCT của este đó có dạng
	A. RCOOR¢.	B. RCOOCH=CHR¢.
	C. RCOOC6H5.	D. C6H5COOR.
(R là gốc hiđrocacbon trong đó cacbon mang hóa trị là cacbon no)
Phản ứng giữa benzen và etylclorua có xúc tác là AlCl3 tạo ra HCl và
	A. toluen.	B. phenylclorua.	C. stiren.	D. etylbenzen.
Hợp chất nào dưới đây tác dụng được với AgNO3/NH3:
CH3-CºCH, CH3CHO, CH3COCH3, CH3-CºC-CH3
	A. CH3-CºCH và CH3-CºC-CH3.
	B. CH3CHO và CH3-CºCH.
	C. CH3-CºC-CH3 và CH3COCH3.
 	D. cả 4 chất trên.
Trong phòng thí nghiệm axetilen có thể điều chế bằng cách
	A. cho nhôm cacbua tác dụng với nước.
	B. đun nóng natri axetat với vôi tôi xút.
	C. cho canxi cacbua tác dụng với nước.
	D. Khử nước của rượu etylic.
Penta-1,3-đien có công thức cấu tạo nào sau đây?
	A. CH2=CH-CH2-CH=CH2.	B. CH2=CH-CH=CH-CH3.
	C. CH2=C=CH-CH2-CH3.	D. CH3-CH2CH=CH-CH3.
Cho quỳ tím vào dung dịch mỗi hợp chất dưới đây, dung dịch nào làm quỳ tím chuyển thành màu xanh?
	A. H2N-CH2COONa.	B. H2N-CH2-COOH.
	C. Cl-NH3+-CH2COOH.	D. HOOC-(CH2)3CH(NH2)COOH.
Chất nào sau đây có thể dùng làm khan rượu etylic?
	A. CaO.	B. CuSO4 khan.	C. Na2SO4 khan.	D. cả A, B, C.
Cho glixerin tác dụng với hỗn hợp 2 axit stearic, panmitic thì tạo ra tối đa bao nhiêu trieste?
	A. 4.	B. 6.	C. 7.	D. 8.
Cộng HBr vào một anken thu được sản phẩm có % Br về khối lượng là 65%. Anken đó là
	A. C2H4.	B. C3H6.	C. C4H8.	D. C5H10.
Glucozơ và fructozơ thuọc loại saccarit nào?
	A. monosaccarit.	B. đisaccarit.
	C. oligosaccarit.	D. polisaccarit
ĐÁP ÁN ĐỀ 10:
1. A
6. D
11. C
16. C
21. C
26. C
31. D
36. A
41. C
46. A
2. B
7. D
12. A
17. B
22. D
27. D
32. C
37. C
42. D
47. D
3. C
8. B
13. B
18. A
23. D
28. D
33. C
38. A
43. B
48. B
4. A
9. B
14. C
19. C
24. B
29. C
34. B
39. B
44. C
49. B
5. D
10. D
15. B
20. D
25. A
30. D
35. C
40. A
45. B
50. A

File đính kèm:

  • docDE THI THU DH 2009MA 10 DAP AN.doc